C15H20N4O2 — CID 166204417
N-[2-[(2-oxoimidazolidin-1-yl)methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 166204417) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[2-[(2-oxoimidazolidin-1-yl)methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-[(2-oxoimidazolidin-1-yl)methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 166204417 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[2-[(2-oxoimidazolidin-1-yl)methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C1NCCN1Cc1ccccc1NC(=O)N1CCCC1 |
| InChI | InChI=1S/C15H20N4O2/c20-14-16-7-10-19(14)11-12-5-1-2-6-13(12)17-15(21)18-8-3-4-9-18/h1-2,5-6H,3-4,7-11H2,(H,16,20)(H,17,21) |
| InChIKey | KSJYBVAKULMKEW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |