C11H12N2O3 — CID 83822306
2-[(2-oxoimidazolidin-1-yl)methyl]benzoic acid (PubChem CID 83822306) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-[(2-oxoimidazolidin-1-yl)methyl]benzoic acid.
| Compound Name | 2-[(2-oxoimidazolidin-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 83822306 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-[(2-oxoimidazolidin-1-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CN1CCNC1=O |
| InChI | InChI=1S/C11H12N2O3/c14-10(15)9-4-2-1-3-8(9)7-13-6-5-12-11(13)16/h1-4H,5-7H2,(H,12,16)(H,14,15) |
| InChIKey | NXYAFNBXNRHORR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |