C15H17N3O4 — CID 82148017
2-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzoic acid (PubChem CID 82148017) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzoic acid.
| Compound Name | 2-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 82148017 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CN1C(=O)NC2(CCNCC2)C1=O |
| InChI | InChI=1S/C15H17N3O4/c19-12(20)11-4-2-1-3-10(11)9-18-13(21)15(17-14(18)22)5-7-16-8-6-15/h1-4,16H,5-9H2,(H,17,22)(H,19,20) |
| InChIKey | NMZZFZAYIIJRKL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|