C19H21N3O2 — CID 75472823
2-(3-methylphenyl)-N-[2-[(2-oxoimidazolidin-1-yl)methyl]phenyl]acetamide (PubChem CID 75472823) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-[2-[(2-oxoimidazolidin-1-yl)methyl]phenyl]acetamide.
| Compound Name | 2-(3-methylphenyl)-N-[2-[(2-oxoimidazolidin-1-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 75472823 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-(3-methylphenyl)-N-[2-[(2-oxoimidazolidin-1-yl)methyl]phenyl]acetamide |
| SMILES | Cc1cccc(CC(=O)Nc2ccccc2CN2CCNC2=O)c1 |
| InChI | InChI=1S/C19H21N3O2/c1-14-5-4-6-15(11-14)12-18(23)21-17-8-3-2-7-16(17)13-22-10-9-20-19(22)24/h2-8,11H,9-10,12-13H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | CAWNBTBVZQVQQL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |