C15H21N3O2 — CID 170035651
6-acetyl-3-benzyl-1,3,6-triazonan-2-one (PubChem CID 170035651) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 6-acetyl-3-benzyl-1,3,6-triazonan-2-one.
| Compound Name | 6-acetyl-3-benzyl-1,3,6-triazonan-2-one |
|---|---|
| PubChem CID | 170035651 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 6-acetyl-3-benzyl-1,3,6-triazonan-2-one |
| SMILES | CC(=O)N1CCCNC(=O)N(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C15H21N3O2/c1-13(19)17-9-5-8-16-15(20)18(11-10-17)12-14-6-3-2-4-7-14/h2-4,6-7H,5,8-12H2,1H3,(H,16,20) |
| InChIKey | ORZOPRUUBIAUKM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |