C19H25N3O3 — CID 97315039
(3S)-1-acetyl-N-[(3R)-1-benzyl-2-oxopyrrolidin-3-yl]piperidine-3-carboxamide (PubChem CID 97315039) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (3S)-1-acetyl-N-[(3R)-1-benzyl-2-oxopyrrolidin-3-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-acetyl-N-[(3R)-1-benzyl-2-oxopyrrolidin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97315039 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (3S)-1-acetyl-N-[(3R)-1-benzyl-2-oxopyrrolidin-3-yl]piperidine-3-carboxamide |
| SMILES | CC(=O)N1CCC[C@H](C(=O)N[C@@H]2CCN(Cc3ccccc3)C2=O)C1 |
| InChI | InChI=1S/C19H25N3O3/c1-14(23)21-10-5-8-16(13-21)18(24)20-17-9-11-22(19(17)25)12-15-6-3-2-4-7-15/h2-4,6-7,16-17H,5,8-13H2,1H3,(H,20,24)/t16-,17+/m0/s1 |
| InChIKey | AWCKWILZLVSALN-DLBZAZTESA-N |
| XLogP | 1.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |