C19H24N2O4 — CID 120674455
4-[(1-benzyl-2-oxopyrrolidin-3-yl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120674455) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-[(1-benzyl-2-oxopyrrolidin-3-yl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(1-benzyl-2-oxopyrrolidin-3-yl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120674455 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 4-[(1-benzyl-2-oxopyrrolidin-3-yl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NC2CCN(Cc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C19H24N2O4/c22-17(14-6-8-15(9-7-14)19(24)25)20-16-10-11-21(18(16)23)12-13-4-2-1-3-5-13/h1-5,14-16H,6-12H2,(H,20,22)(H,24,25) |
| InChIKey | UFLPZYWGEKUCKF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |