C14H18N2O2S — CID 107031205
4-(3-phenyl-2-sulfanylpropanoyl)-1,4-diazepan-2-one (PubChem CID 107031205) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-(3-phenyl-2-sulfanylpropanoyl)-1,4-diazepan-2-one.
| Compound Name | 4-(3-phenyl-2-sulfanylpropanoyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 107031205 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-(3-phenyl-2-sulfanylpropanoyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)C(S)Cc2ccccc2)CCCN1 |
| InChI | InChI=1S/C14H18N2O2S/c17-13-10-16(8-4-7-15-13)14(18)12(19)9-11-5-2-1-3-6-11/h1-3,5-6,12,19H,4,7-10H2,(H,15,17) |
| InChIKey | RACGXWBEIWHSEQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|