C17H24N2OS — CID 107029275
1-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-3-phenyl-2-sulfanylpropan-1-one (PubChem CID 107029275) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 1-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-3-phenyl-2-sulfanylpropan-1-one.
| Compound Name | 1-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-3-phenyl-2-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 107029275 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-3-phenyl-2-sulfanylpropan-1-one |
| SMILES | O=C(C(S)Cc1ccccc1)N1CCCN2CCCC2C1 |
| InChI | InChI=1S/C17H24N2OS/c20-17(16(21)12-14-6-2-1-3-7-14)19-11-5-10-18-9-4-8-15(18)13-19/h1-3,6-7,15-16,21H,4-5,8-13H2 |
| InChIKey | OKCXLWWJOOIZIA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|