C17H27Cl2N3O — CID 119858252
2-amino-2-phenyl-1-(3-pyrrolidin-1-ylpiperidin-1-yl)ethanone;dihydrochloride (PubChem CID 119858252) has the molecular formula C17H27Cl2N3O and a molecular weight of 360.33 g/mol. Its IUPAC name is 2-amino-2-phenyl-1-(3-pyrrolidin-1-ylpiperidin-1-yl)ethanone;dihydrochloride.
| Compound Name | 2-amino-2-phenyl-1-(3-pyrrolidin-1-ylpiperidin-1-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119858252 |
| Molecular Formula | C17H27Cl2N3O |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-amino-2-phenyl-1-(3-pyrrolidin-1-ylpiperidin-1-yl)ethanone;dihydrochloride |
| SMILES | Cl.Cl.NC(C(=O)N1CCCC(N2CCCC2)C1)c1ccccc1 |
| InChI | InChI=1S/C17H25N3O.2ClH/c18-16(14-7-2-1-3-8-14)17(21)20-12-6-9-15(13-20)19-10-4-5-11-19;;/h1-3,7-8,15-16H,4-6,9-13,18H2;2*1H |
| InChIKey | YTMKVZCOYHDYGU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |