C18H26ClN3O3 — CID 119277072
2-amino-1-[3-(morpholine-4-carbonyl)piperidin-1-yl]-2-phenylethanone;hydrochloride (PubChem CID 119277072) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is 2-amino-1-[3-(morpholine-4-carbonyl)piperidin-1-yl]-2-phenylethanone;hydrochloride.
| Compound Name | 2-amino-1-[3-(morpholine-4-carbonyl)piperidin-1-yl]-2-phenylethanone;hydrochloride |
|---|---|
| PubChem CID | 119277072 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-amino-1-[3-(morpholine-4-carbonyl)piperidin-1-yl]-2-phenylethanone;hydrochloride |
| SMILES | Cl.NC(C(=O)N1CCCC(C(=O)N2CCOCC2)C1)c1ccccc1 |
| InChI | InChI=1S/C18H25N3O3.ClH/c19-16(14-5-2-1-3-6-14)18(23)21-8-4-7-15(13-21)17(22)20-9-11-24-12-10-20;/h1-3,5-6,15-16H,4,7-13,19H2;1H |
| InChIKey | LPUCFAIQCFNDFT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |