C14H17N3O4 — CID 104899074
(2S)-2-[(3-oxo-1,4-diazepane-1-carbonyl)amino]-2-phenylacetic acid (PubChem CID 104899074) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is (2S)-2-[(3-oxo-1,4-diazepane-1-carbonyl)amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[(3-oxo-1,4-diazepane-1-carbonyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 104899074 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2S)-2-[(3-oxo-1,4-diazepane-1-carbonyl)amino]-2-phenylacetic acid |
| SMILES | O=C1CN(C(=O)N[C@H](C(=O)O)c2ccccc2)CCCN1 |
| InChI | InChI=1S/C14H17N3O4/c18-11-9-17(8-4-7-15-11)14(21)16-12(13(19)20)10-5-2-1-3-6-10/h1-3,5-6,12H,4,7-9H2,(H,15,18)(H,16,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | AUFAZAREZMULTM-LBPRGKRZSA-N |
| XLogP | 0.34 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |