C14H18N2O3S — CID 104898970
(2S)-2-phenyl-2-(1,4-thiazepane-4-carbonylamino)acetic acid (PubChem CID 104898970) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is (2S)-2-phenyl-2-(1,4-thiazepane-4-carbonylamino)acetic acid.
| Compound Name | (2S)-2-phenyl-2-(1,4-thiazepane-4-carbonylamino)acetic acid |
|---|---|
| PubChem CID | 104898970 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2S)-2-phenyl-2-(1,4-thiazepane-4-carbonylamino)acetic acid |
| SMILES | O=C(O)[C@@H](NC(=O)N1CCCSCC1)c1ccccc1 |
| InChI | InChI=1S/C14H18N2O3S/c17-13(18)12(11-5-2-1-3-6-11)15-14(19)16-7-4-9-20-10-8-16/h1-3,5-6,12H,4,7-10H2,(H,15,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | XIKXGYBCBIPTIO-LBPRGKRZSA-N |
| XLogP | 1.96 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |