C15H21N3O3 — CID 61193066
(2R)-2-[(4-methyl-1,4-diazepane-1-carbonyl)amino]-2-phenylacetic acid (PubChem CID 61193066) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is (2R)-2-[(4-methyl-1,4-diazepane-1-carbonyl)amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[(4-methyl-1,4-diazepane-1-carbonyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 61193066 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2R)-2-[(4-methyl-1,4-diazepane-1-carbonyl)amino]-2-phenylacetic acid |
| SMILES | CN1CCCN(C(=O)N[C@@H](C(=O)O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H21N3O3/c1-17-8-5-9-18(11-10-17)15(21)16-13(14(19)20)12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3,(H,16,21)(H,19,20)/t13-/m1/s1 |
| InChIKey | SJIYHSZTWYLUOA-CYBMUJFWSA-N |
| XLogP | 1.16 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |