C15H20N2O3S — CID 104899061
(2S)-2-[(2,6-dimethylthiomorpholine-4-carbonyl)amino]-2-phenylacetic acid (PubChem CID 104899061) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is (2S)-2-[(2,6-dimethylthiomorpholine-4-carbonyl)amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[(2,6-dimethylthiomorpholine-4-carbonyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 104899061 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (2S)-2-[(2,6-dimethylthiomorpholine-4-carbonyl)amino]-2-phenylacetic acid |
| SMILES | CC1CN(C(=O)N[C@H](C(=O)O)c2ccccc2)CC(C)S1 |
| InChI | InChI=1S/C15H20N2O3S/c1-10-8-17(9-11(2)21-10)15(20)16-13(14(18)19)12-6-4-3-5-7-12/h3-7,10-11,13H,8-9H2,1-2H3,(H,16,20)(H,18,19)/t10?,11?,13-/m0/s1 |
| InChIKey | PABGMABDTCCJMS-XIVSLSHWSA-N |
| XLogP | 2.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |