C20H24N2OS — CID 87000158
N-(1,2-diphenylethyl)-1,4-thiazepane-4-carboxamide (PubChem CID 87000158) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-1,4-thiazepane-4-carboxamide.
| Compound Name | N-(1,2-diphenylethyl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 87000158 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-(1,2-diphenylethyl)-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NC(Cc1ccccc1)c1ccccc1)N1CCCSCC1 |
| InChI | InChI=1S/C20H24N2OS/c23-20(22-12-7-14-24-15-13-22)21-19(18-10-5-2-6-11-18)16-17-8-3-1-4-9-17/h1-6,8-11,19H,7,12-16H2,(H,21,23) |
| InChIKey | VXMYHDAONLKEET-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |