C20H23N3O2 — CID 95306843
N-[(1S)-1,2-diphenylethyl]-5-oxo-1,4-diazepane-1-carboxamide (PubChem CID 95306843) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(1S)-1,2-diphenylethyl]-5-oxo-1,4-diazepane-1-carboxamide.
| Compound Name | N-[(1S)-1,2-diphenylethyl]-5-oxo-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 95306843 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[(1S)-1,2-diphenylethyl]-5-oxo-1,4-diazepane-1-carboxamide |
| SMILES | O=C1CCN(C(=O)N[C@@H](Cc2ccccc2)c2ccccc2)CCN1 |
| InChI | InChI=1S/C20H23N3O2/c24-19-11-13-23(14-12-21-19)20(25)22-18(17-9-5-2-6-10-17)15-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,21,24)(H,22,25)/t18-/m0/s1 |
| InChIKey | VQWKMTBCHCCWKM-SFHVURJKSA-N |
| XLogP | 2.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |