C14H18N2O2S — CID 55154739
1-(2-benzylsulfanylacetyl)-1,4-diazepan-5-one (PubChem CID 55154739) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-(2-benzylsulfanylacetyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-benzylsulfanylacetyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 55154739 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-(2-benzylsulfanylacetyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)CSCc2ccccc2)CCN1 |
| InChI | InChI=1S/C14H18N2O2S/c17-13-6-8-16(9-7-15-13)14(18)11-19-10-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,15,17) |
| InChIKey | WMJDXJGMZUAABZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |