C14H18N2O4S — CID 62045405
1-[3-(benzenesulfonyl)propanoyl]-1,4-diazepan-5-one (PubChem CID 62045405) has the molecular formula C14H18N2O4S and a molecular weight of 310.37 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propanoyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(benzenesulfonyl)propanoyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62045405 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propanoyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)CCS(=O)(=O)c2ccccc2)CCN1 |
| InChI | InChI=1S/C14H18N2O4S/c17-13-6-9-16(10-8-15-13)14(18)7-11-21(19,20)12-4-2-1-3-5-12/h1-5H,6-11H2,(H,15,17) |
| InChIKey | CGMDMGHOEIGZAJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |