C17H27N3O3S — CID 138668425
3-(benzenesulfonyl)-1-(9-methyl-1,4,7-triazecan-1-yl)propan-1-one (PubChem CID 138668425) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-(9-methyl-1,4,7-triazecan-1-yl)propan-1-one.
| Compound Name | 3-(benzenesulfonyl)-1-(9-methyl-1,4,7-triazecan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 138668425 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 3-(benzenesulfonyl)-1-(9-methyl-1,4,7-triazecan-1-yl)propan-1-one |
| SMILES | CC1CNCCNCCN(C(=O)CCS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H27N3O3S/c1-15-13-19-9-8-18-10-11-20(14-15)17(21)7-12-24(22,23)16-5-3-2-4-6-16/h2-6,15,18-19H,7-14H2,1H3 |
| InChIKey | FMZLWPOFSMZOTO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |