C16H23NO3S — CID 17310076
3-(benzenesulfonyl)-1-(3,5-dimethylpiperidin-1-yl)propan-1-one (PubChem CID 17310076) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-(3,5-dimethylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-(benzenesulfonyl)-1-(3,5-dimethylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 17310076 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-(benzenesulfonyl)-1-(3,5-dimethylpiperidin-1-yl)propan-1-one |
| SMILES | CC1CC(C)CN(C(=O)CCS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H23NO3S/c1-13-10-14(2)12-17(11-13)16(18)8-9-21(19,20)15-6-4-3-5-7-15/h3-7,13-14H,8-12H2,1-2H3 |
| InChIKey | SRQANXCIOGQLEK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |