C19H28N2O2 — CID 110201364
5-(4-phenylbutanoyl)-1,5-diazacycloundecan-2-one (PubChem CID 110201364) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 5-(4-phenylbutanoyl)-1,5-diazacycloundecan-2-one.
| Compound Name | 5-(4-phenylbutanoyl)-1,5-diazacycloundecan-2-one |
|---|---|
| PubChem CID | 110201364 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 5-(4-phenylbutanoyl)-1,5-diazacycloundecan-2-one |
| SMILES | O=C1CCN(C(=O)CCCc2ccccc2)CCCCCCN1 |
| InChI | InChI=1S/C19H28N2O2/c22-18-13-16-21(15-7-2-1-6-14-20-18)19(23)12-8-11-17-9-4-3-5-10-17/h3-5,9-10H,1-2,6-8,11-16H2,(H,20,22) |
| InChIKey | DYRBFVRSJRGKFN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |