C19H20N2O2 — CID 71943621
1-[2-(4-phenylphenyl)acetyl]-1,4-diazepan-5-one (PubChem CID 71943621) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-[2-(4-phenylphenyl)acetyl]-1,4-diazepan-5-one.
| Compound Name | 1-[2-(4-phenylphenyl)acetyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 71943621 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-[2-(4-phenylphenyl)acetyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)Cc2ccc(-c3ccccc3)cc2)CCN1 |
| InChI | InChI=1S/C19H20N2O2/c22-18-10-12-21(13-11-20-18)19(23)14-15-6-8-17(9-7-15)16-4-2-1-3-5-16/h1-9H,10-14H2,(H,20,22) |
| InChIKey | XZFDCLUAPRTGEO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |