C23H34N4O3 — CID 110201725
N-benzyl-4-(4-oxo-1,5-diazacycloundecane-1-carbonyl)piperidine-1-carboxamide (PubChem CID 110201725) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-benzyl-4-(4-oxo-1,5-diazacycloundecane-1-carbonyl)piperidine-1-carboxamide.
| Compound Name | N-benzyl-4-(4-oxo-1,5-diazacycloundecane-1-carbonyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 110201725 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | N-benzyl-4-(4-oxo-1,5-diazacycloundecane-1-carbonyl)piperidine-1-carboxamide |
| SMILES | O=C1CCN(C(=O)C2CCN(C(=O)NCc3ccccc3)CC2)CCCCCCN1 |
| InChI | InChI=1S/C23H34N4O3/c28-21-12-17-26(14-7-2-1-6-13-24-21)22(29)20-10-15-27(16-11-20)23(30)25-18-19-8-4-3-5-9-19/h3-5,8-9,20H,1-2,6-7,10-18H2,(H,24,28)(H,25,30) |
| InChIKey | QZOBJTSOWDSFHL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |