C15H20N2O3 — CID 29257758
4-(4-phenoxybutanoyl)-1,4-diazepan-2-one (PubChem CID 29257758) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-(4-phenoxybutanoyl)-1,4-diazepan-2-one.
| Compound Name | 4-(4-phenoxybutanoyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 29257758 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-(4-phenoxybutanoyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)CCCOc2ccccc2)CCCN1 |
| InChI | InChI=1S/C15H20N2O3/c18-14-12-17(10-5-9-16-14)15(19)8-4-11-20-13-6-2-1-3-7-13/h1-3,6-7H,4-5,8-12H2,(H,16,18) |
| InChIKey | ZXDCJHPYIHSSCL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|