C13H17N3O3 — CID 62898319
4-[3-(2-oxo-1-pyridinyl)propanoyl]-1,4-diazepan-2-one (PubChem CID 62898319) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-[3-(2-oxo-1-pyridinyl)propanoyl]-1,4-diazepan-2-one.
| Compound Name | 4-[3-(2-oxo-1-pyridinyl)propanoyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 62898319 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-[3-(2-oxo-1-pyridinyl)propanoyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)CCn2ccccc2=O)CCCN1 |
| InChI | InChI=1S/C13H17N3O3/c17-11-10-16(8-3-6-14-11)13(19)5-9-15-7-2-1-4-12(15)18/h1-2,4,7H,3,5-6,8-10H2,(H,14,17) |
| InChIKey | IFVAESVFOUWTBN-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |