C12H17N3O4 — CID 62897036
1-[3-oxo-3-(3-oxo-1,4-diazepan-1-yl)propyl]pyrrolidine-2,5-dione (PubChem CID 62897036) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-[3-oxo-3-(3-oxo-1,4-diazepan-1-yl)propyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-oxo-3-(3-oxo-1,4-diazepan-1-yl)propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 62897036 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-[3-oxo-3-(3-oxo-1,4-diazepan-1-yl)propyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CN(C(=O)CCN2C(=O)CCC2=O)CCCN1 |
| InChI | InChI=1S/C12H17N3O4/c16-9-8-14(6-1-5-13-9)10(17)4-7-15-11(18)2-3-12(15)19/h1-8H2,(H,13,16) |
| InChIKey | MQGIAZYYZNOCDP-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|