C9H17N3O2 — CID 65366461
4-(3-aminobutanoyl)-1,4-diazepan-2-one (PubChem CID 65366461) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-(3-aminobutanoyl)-1,4-diazepan-2-one.
| Compound Name | 4-(3-aminobutanoyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65366461 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 4-(3-aminobutanoyl)-1,4-diazepan-2-one |
| SMILES | CC(N)CC(=O)N1CCCNC(=O)C1 |
| InChI | InChI=1S/C9H17N3O2/c1-7(10)5-9(14)12-4-2-3-11-8(13)6-12/h7H,2-6,10H2,1H3,(H,11,13) |
| InChIKey | PNGLPKTYMBYTST-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |