C10H18N2O2 — CID 62898703
4-pentanoyl-1,4-diazepan-2-one (PubChem CID 62898703) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 4-pentanoyl-1,4-diazepan-2-one.
| Compound Name | 4-pentanoyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 62898703 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 4-pentanoyl-1,4-diazepan-2-one |
| SMILES | CCCCC(=O)N1CCCNC(=O)C1 |
| InChI | InChI=1S/C10H18N2O2/c1-2-3-5-10(14)12-7-4-6-11-9(13)8-12/h2-8H2,1H3,(H,11,13) |
| InChIKey | YLAOONRXQFMUHE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |