C16H19N3O2 — CID 72878834
4-phenoxy-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)butan-1-one (PubChem CID 72878834) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-phenoxy-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)butan-1-one.
| Compound Name | 4-phenoxy-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)butan-1-one |
|---|---|
| PubChem CID | 72878834 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-phenoxy-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)butan-1-one |
| SMILES | O=C(CCCOc1ccccc1)N1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C16H19N3O2/c20-16(7-4-10-21-13-5-2-1-3-6-13)19-9-8-14-15(11-19)18-12-17-14/h1-3,5-6,12H,4,7-11H2,(H,17,18) |
| InChIKey | QPNVWOWAMSYGPD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|