C8H10ClN3O — CID 131057090
2-chloro-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone (PubChem CID 131057090) has the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. Its IUPAC name is 2-chloro-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone.
| Compound Name | 2-chloro-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 131057090 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2-chloro-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone |
| SMILES | O=C(CCl)N1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C8H10ClN3O/c9-3-8(13)12-2-1-6-7(4-12)11-5-10-6/h5H,1-4H2,(H,10,11) |
| InChIKey | UNJNGXBAGXKGJR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|