C15H25N3O — CID 143098139
2,2,4,4-tetramethyl-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)pentan-1-one (PubChem CID 143098139) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)pentan-1-one.
| Compound Name | 2,2,4,4-tetramethyl-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)pentan-1-one |
|---|---|
| PubChem CID | 143098139 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2,2,4,4-tetramethyl-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)pentan-1-one |
| SMILES | CC(C)(C)CC(C)(C)C(=O)N1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C15H25N3O/c1-14(2,3)9-15(4,5)13(19)18-7-6-11-12(8-18)17-10-16-11/h10H,6-9H2,1-5H3,(H,16,17) |
| InChIKey | HSJPVHGZXGDFIN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |