C8H12N4OS — CID 57079776
N-methyl-N-sulfanyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide (PubChem CID 57079776) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is N-methyl-N-sulfanyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide.
| Compound Name | N-methyl-N-sulfanyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 57079776 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | N-methyl-N-sulfanyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide |
| SMILES | CN(S)C(=O)N1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C8H12N4OS/c1-11(14)8(13)12-3-2-6-7(4-12)10-5-9-6/h5,14H,2-4H2,1H3,(H,9,10) |
| InChIKey | AARQHURJLIMZCX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|