C16H21N3O2 — CID 168833923
(5R)-9-acetyl-6-benzyl-2,6,9-triazaspiro[4.5]decan-1-one (PubChem CID 168833923) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (5R)-9-acetyl-6-benzyl-2,6,9-triazaspiro[4.5]decan-1-one.
| Compound Name | (5R)-9-acetyl-6-benzyl-2,6,9-triazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 168833923 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (5R)-9-acetyl-6-benzyl-2,6,9-triazaspiro[4.5]decan-1-one |
| SMILES | CC(=O)N1CCN(Cc2ccccc2)[C@]2(CCNC2=O)C1 |
| InChI | InChI=1S/C16H21N3O2/c1-13(20)18-9-10-19(11-14-5-3-2-4-6-14)16(12-18)7-8-17-15(16)21/h2-6H,7-12H2,1H3,(H,17,21)/t16-/m1/s1 |
| InChIKey | PBOQGZMYJFTPPW-MRXNPFEDSA-N |
| XLogP | 0.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |