C18H26N2O2 — CID 66888528
tert-butyl 4-benzyl-4,7-diazaspiro[2.5]octane-7-carboxylate (PubChem CID 66888528) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is tert-butyl 4-benzyl-4,7-diazaspiro[2.5]octane-7-carboxylate.
| Compound Name | tert-butyl 4-benzyl-4,7-diazaspiro[2.5]octane-7-carboxylate |
|---|---|
| PubChem CID | 66888528 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl 4-benzyl-4,7-diazaspiro[2.5]octane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccccc2)C2(CC2)C1 |
| InChI | InChI=1S/C18H26N2O2/c1-17(2,3)22-16(21)19-11-12-20(18(14-19)9-10-18)13-15-7-5-4-6-8-15/h4-8H,9-14H2,1-3H3 |
| InChIKey | CGVJJNCZXFLRHA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |