C16H22N3O2P — CID 170035762
6-benzyl-9-(2-phosphanylacetyl)-2,6,9-triazaspiro[4.5]decan-1-one (PubChem CID 170035762) has the molecular formula C16H22N3O2P and a molecular weight of 319.34 g/mol. Its IUPAC name is 6-benzyl-9-(2-phosphanylacetyl)-2,6,9-triazaspiro[4.5]decan-1-one.
| Compound Name | 6-benzyl-9-(2-phosphanylacetyl)-2,6,9-triazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 170035762 |
| Molecular Formula | C16H22N3O2P |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 6-benzyl-9-(2-phosphanylacetyl)-2,6,9-triazaspiro[4.5]decan-1-one |
| SMILES | O=C(CP)N1CCN(Cc2ccccc2)C2(CCNC2=O)C1 |
| InChI | InChI=1S/C16H22N3O2P/c20-14(11-22)18-8-9-19(10-13-4-2-1-3-5-13)16(12-18)6-7-17-15(16)21/h1-5H,6-12,22H2,(H,17,21) |
| InChIKey | MYCJJYOYISQODK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|