C18H29N3O — CID 120565406
4-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)pentan-1-one (PubChem CID 120565406) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)pentan-1-one.
| Compound Name | 4-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 120565406 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 4-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)pentan-1-one |
| SMILES | CC(N)CCC(=O)N1CCN(Cc2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C18H29N3O/c1-15(19)9-10-17(22)20-11-12-21(18(2,3)14-20)13-16-7-5-4-6-8-16/h4-8,15H,9-14,19H2,1-3H3 |
| InChIKey | FDRXUKLGBIKLGB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |