C20H33N3O — CID 119878630
7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one (PubChem CID 119878630) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one.
| Compound Name | 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one |
|---|---|
| PubChem CID | 119878630 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one |
| SMILES | CC1(C)CN(C(=O)CCCCCCN)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H33N3O/c1-20(2)17-22(19(24)12-8-3-4-9-13-21)14-15-23(20)16-18-10-6-5-7-11-18/h5-7,10-11H,3-4,8-9,12-17,21H2,1-2H3 |
| InChIKey | FVLJULYQKYGJQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|