About 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one
7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one (PubChem CID 119878630) has the molecular formula C20H33N3O
and a molecular weight of 331.50 g/mol. Its IUPAC name is 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one.
Molecular Properties
| Compound Name | 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one |
| PubChem CID | 119878630 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one |
| SMILES | CC1(C)CN(C(=O)CCCCCCN)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H33N3O/c1-20(2)17-22(19(24)12-8-3-4-9-13-21)14-15-23(20)16-18-10-6-5-7-11-18/h5-7,10-11H,3-4,8-9,12-17,21H2,1-2H3 |
| InChIKey | FVLJULYQKYGJQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one?
The IUPAC name of 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one (CID 119878630) is 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one.
What is the SMILES notation for 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one?
The canonical SMILES for 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one is CC1(C)CN(C(=O)CCCCCCN)CCN1Cc1ccccc1.
What is the InChIKey of 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one?
The InChIKey is FVLJULYQKYGJQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N3O/c1-20(2)17-22(19(24)12-8-3-4-9-13-21)14-15-23(20)16-18-10-6-5-7-11-18/h5-7,10-11H,3-4,8-9,12-17,21H2,1-2H3.
What are the key properties of 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one?
7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one has a molecular weight of 331.50 g/mol, XLogP of 3.02, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-1-(4-benzyl-3,3-dimethylpiperazin-1-yl)heptan-1-one is sourced from PubChem (CID 119878630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).