5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid

C14H18N2O3 — CID 137480761

IUPAC5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid
SMILESO=C(O)N1CCN(Cc2ccccc2)C2(COC2)C1
InChIInChI=1S/C14H18N2O3/c17-13(18)15-6-7-16(14(9-15)10-19-11-14)8-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,17,18)
InChIKeyGNMATFINJCRINZ-UHFFFAOYSA-N
MW262.31 g/mol
LogP1.25
Rot. Bonds2

About 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid

5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid (PubChem CID 137480761) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid.

Molecular Properties

Compound Name5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid
PubChem CID137480761
Molecular FormulaC14H18N2O3
Molecular Weight262.31 g/mol
Exact Mass262.13
IUPAC Name5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid
SMILESO=C(O)N1CCN(Cc2ccccc2)C2(COC2)C1
InChIInChI=1S/C14H18N2O3/c17-13(18)15-6-7-16(14(9-15)10-19-11-14)8-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,17,18)
InChIKeyGNMATFINJCRINZ-UHFFFAOYSA-N
XLogP1.25
TPSA53.01 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.31
LogP ≤ 51.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid?
The IUPAC name of 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid (CID 137480761) is 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid.
What is the SMILES notation for 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid?
The canonical SMILES for 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid is O=C(O)N1CCN(Cc2ccccc2)C2(COC2)C1.
What is the InChIKey of 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid?
The InChIKey is GNMATFINJCRINZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c17-13(18)15-6-7-16(14(9-15)10-19-11-14)8-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,17,18).
What are the key properties of 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid?
5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid has a molecular weight of 262.31 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2-oxa-5,8-diazaspiro[3.5]nonane-8-carboxylic acid is sourced from PubChem (CID 137480761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).