C23H27ClN2O — CID 131647501
1-(1-benzyl-1,9-diazaspiro[4.5]decan-9-yl)-2-(4-chlorophenyl)ethanone (PubChem CID 131647501) has the molecular formula C23H27ClN2O and a molecular weight of 382.94 g/mol. Its IUPAC name is 1-(1-benzyl-1,9-diazaspiro[4.5]decan-9-yl)-2-(4-chlorophenyl)ethanone.
| Compound Name | 1-(1-benzyl-1,9-diazaspiro[4.5]decan-9-yl)-2-(4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 131647501 |
| Molecular Formula | C23H27ClN2O |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-(1-benzyl-1,9-diazaspiro[4.5]decan-9-yl)-2-(4-chlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1CCCC2(CCCN2Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H27ClN2O/c24-21-10-8-19(9-11-21)16-22(27)25-14-4-12-23(18-25)13-5-15-26(23)17-20-6-2-1-3-7-20/h1-3,6-11H,4-5,12-18H2 |
| InChIKey | AJEBRTIJKUNDNG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |