C20H23N3O — CID 95043573
[(5S)-1-benzyl-1,7-diazaspiro[4.4]nonan-7-yl]-pyridin-4-ylmethanone (PubChem CID 95043573) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is [(5S)-1-benzyl-1,7-diazaspiro[4.4]nonan-7-yl]-pyridin-4-ylmethanone.
| Compound Name | [(5S)-1-benzyl-1,7-diazaspiro[4.4]nonan-7-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 95043573 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | [(5S)-1-benzyl-1,7-diazaspiro[4.4]nonan-7-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CC[C@@]2(CCCN2Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H23N3O/c24-19(18-7-11-21-12-8-18)22-14-10-20(16-22)9-4-13-23(20)15-17-5-2-1-3-6-17/h1-3,5-8,11-12H,4,9-10,13-16H2/t20-/m0/s1 |
| InChIKey | BBBWTEUJXRQTHO-FQEVSTJZSA-N |
| XLogP | 2.96 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |