C16H21NO3 — CID 129410416
ethyl (7S)-5-benzyl-2-oxa-5-azaspiro[3.4]octane-7-carboxylate (PubChem CID 129410416) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethyl (7S)-5-benzyl-2-oxa-5-azaspiro[3.4]octane-7-carboxylate.
| Compound Name | ethyl (7S)-5-benzyl-2-oxa-5-azaspiro[3.4]octane-7-carboxylate |
|---|---|
| PubChem CID | 129410416 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | ethyl (7S)-5-benzyl-2-oxa-5-azaspiro[3.4]octane-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(Cc2ccccc2)C2(COC2)C1 |
| InChI | InChI=1S/C16H21NO3/c1-2-20-15(18)14-8-16(11-19-12-16)17(10-14)9-13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3/t14-/m0/s1 |
| InChIKey | SJKHOHNOQUUEBH-AWEZNQCLSA-N |
| XLogP | 1.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |