C21H29NO4 — CID 126657992
ethyl (4'aR,8'aR)-1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-carboxylate (PubChem CID 126657992) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is ethyl (4'aR,8'aR)-1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-carboxylate.
| Compound Name | ethyl (4'aR,8'aR)-1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-carboxylate |
|---|---|
| PubChem CID | 126657992 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | ethyl (4'aR,8'aR)-1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-carboxylate |
| SMILES | CCOC(=O)C1C[C@@H]2CC3(CC[C@H]2N(Cc2ccccc2)C1)OCCO3 |
| InChI | InChI=1S/C21H29NO4/c1-2-24-20(23)18-12-17-13-21(25-10-11-26-21)9-8-19(17)22(15-18)14-16-6-4-3-5-7-16/h3-7,17-19H,2,8-15H2,1H3/t17-,18?,19-/m1/s1 |
| InChIKey | PPVUWQPKJIJTIB-ZYYFHIKCSA-N |
| XLogP | 2.98 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |