C20H27NO3 — CID 118488840
1-(1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl)ethanone (PubChem CID 118488840) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-(1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl)ethanone.
| Compound Name | 1-(1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl)ethanone |
|---|---|
| PubChem CID | 118488840 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-(1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl)ethanone |
| SMILES | CC(=O)C1CC2CC3(CCC2N(Cc2ccccc2)C1)OCCO3 |
| InChI | InChI=1S/C20H27NO3/c1-15(22)18-11-17-12-20(23-9-10-24-20)8-7-19(17)21(14-18)13-16-5-3-2-4-6-16/h2-6,17-19H,7-14H2,1H3 |
| InChIKey | KBGXYIDOQRCSDJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |