C25H40N4O3 — CID 144644570
3-[(3'S,4'aR)-1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea (PubChem CID 144644570) has the molecular formula C25H40N4O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is 3-[(3'S,4'aR)-1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea.
| Compound Name | 3-[(3'S,4'aR)-1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea |
|---|---|
| PubChem CID | 144644570 |
| Molecular Formula | C25H40N4O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 3-[(3'S,4'aR)-1'-benzylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea |
| SMILES | CCN(CCN(C)C)C(=O)N[C@H]1C[C@@H]2CC3(CCC2N(Cc2ccccc2)C1)OCCO3 |
| InChI | InChI=1S/C25H40N4O3/c1-4-28(13-12-27(2)3)24(30)26-22-16-21-17-25(31-14-15-32-25)11-10-23(21)29(19-22)18-20-8-6-5-7-9-20/h5-9,21-23H,4,10-19H2,1-3H3,(H,26,30)/t21-,22+,23?/m1/s1 |
| InChIKey | ITGGCAQQKRIUQN-AXWGZAFASA-N |
| XLogP | 2.77 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |