C26H41N5O2 — CID 118483961
3-[(3S,4aR,8aR)-1-benzyl-7-(dimethylaminomethylidene)-6-oxo-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea (PubChem CID 118483961) has the molecular formula C26H41N5O2 and a molecular weight of 455.65 g/mol. Its IUPAC name is 3-[(3S,4aR,8aR)-1-benzyl-7-(dimethylaminomethylidene)-6-oxo-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea.
| Compound Name | 3-[(3S,4aR,8aR)-1-benzyl-7-(dimethylaminomethylidene)-6-oxo-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea |
|---|---|
| PubChem CID | 118483961 |
| Molecular Formula | C26H41N5O2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.33 |
| IUPAC Name | 3-[(3S,4aR,8aR)-1-benzyl-7-(dimethylaminomethylidene)-6-oxo-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea |
| SMILES | CCN(CCN(C)C)C(=O)N[C@H]1C[C@@H]2CC(=O)C(=CN(C)C)C[C@H]2N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C26H41N5O2/c1-6-30(13-12-28(2)3)26(33)27-23-14-21-16-25(32)22(18-29(4)5)15-24(21)31(19-23)17-20-10-8-7-9-11-20/h7-11,18,21,23-24H,6,12-17,19H2,1-5H3,(H,27,33)/t21-,23+,24-/m1/s1 |
| InChIKey | RAJOWHHESZJKEM-YFNKSVMNSA-N |
| XLogP | 2.65 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|