C23H36N4O2 — CID 144644437
3-[(4aR,8aR)-1-benzyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea (PubChem CID 144644437) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 3-[(4aR,8aR)-1-benzyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea.
| Compound Name | 3-[(4aR,8aR)-1-benzyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea |
|---|---|
| PubChem CID | 144644437 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 3-[(4aR,8aR)-1-benzyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-1-[2-(dimethylamino)ethyl]-1-ethylurea |
| SMILES | CCN(CCN(C)C)C(=O)NC1C[C@@H]2CC(=O)CC[C@H]2N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H36N4O2/c1-4-26(13-12-25(2)3)23(29)24-20-14-19-15-21(28)10-11-22(19)27(17-20)16-18-8-6-5-7-9-18/h5-9,19-20,22H,4,10-17H2,1-3H3,(H,24,29)/t19-,20?,22-/m1/s1 |
| InChIKey | MXDLOJIJANLSLV-ZAWSQKNBSA-N |
| XLogP | 2.59 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |