C26H41N3O2 — CID 158298200
2-[(3R,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-N-[2-[benzyl(methyl)amino]ethyl]-N-ethylacetamide (PubChem CID 158298200) has the molecular formula C26H41N3O2 and a molecular weight of 427.63 g/mol. Its IUPAC name is 2-[(3R,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-N-[2-[benzyl(methyl)amino]ethyl]-N-ethylacetamide.
| Compound Name | 2-[(3R,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-N-[2-[benzyl(methyl)amino]ethyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 158298200 |
| Molecular Formula | C26H41N3O2 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.32 |
| IUPAC Name | 2-[(3R,4aR,8aR)-6-oxo-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-3-yl]-N-[2-[benzyl(methyl)amino]ethyl]-N-ethylacetamide |
| SMILES | CCCN1C[C@@H](CC(=O)N(CC)CCN(C)Cc2ccccc2)C[C@@H]2CC(=O)CC[C@H]21 |
| InChI | InChI=1S/C26H41N3O2/c1-4-13-29-20-22(16-23-18-24(30)11-12-25(23)29)17-26(31)28(5-2)15-14-27(3)19-21-9-7-6-8-10-21/h6-10,22-23,25H,4-5,11-20H2,1-3H3/t22-,23-,25-/m1/s1 |
| InChIKey | GMEDFBDUGPFYSC-VDKIKQQVSA-N |
| XLogP | 3.83 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |