C18H25NO4 — CID 70324739
diethyl 1-benzyl-3-methylpyrrolidine-3,4-dicarboxylate (PubChem CID 70324739) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is diethyl 1-benzyl-3-methylpyrrolidine-3,4-dicarboxylate.
| Compound Name | diethyl 1-benzyl-3-methylpyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 70324739 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | diethyl 1-benzyl-3-methylpyrrolidine-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1CN(Cc2ccccc2)CC1(C)C(=O)OCC |
| InChI | InChI=1S/C18H25NO4/c1-4-22-16(20)15-12-19(11-14-9-7-6-8-10-14)13-18(15,3)17(21)23-5-2/h6-10,15H,4-5,11-13H2,1-3H3 |
| InChIKey | OKAIVXLYLSIPHQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |