1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid

C14H19NO2 — CID 5081554

IUPAC1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid
SMILESCC1(C)CN(Cc2ccccc2)CC1C(=O)O
InChIInChI=1S/C14H19NO2/c1-14(2)10-15(9-12(14)13(16)17)8-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,16,17)
InChIKeyYLHKSZFLQXTQKA-UHFFFAOYSA-N
MW233.31 g/mol
LogP2.23
Rot. Bonds3

About 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid

1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid (PubChem CID 5081554) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid
PubChem CID5081554
Molecular FormulaC14H19NO2
Molecular Weight233.31 g/mol
Exact Mass233.14
IUPAC Name1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid
SMILESCC1(C)CN(Cc2ccccc2)CC1C(=O)O
InChIInChI=1S/C14H19NO2/c1-14(2)10-15(9-12(14)13(16)17)8-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,16,17)
InChIKeyYLHKSZFLQXTQKA-UHFFFAOYSA-N
XLogP2.23
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.31
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid?
The IUPAC name of 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid (CID 5081554) is 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid is CC1(C)CN(Cc2ccccc2)CC1C(=O)O.
What is the InChIKey of 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid?
The InChIKey is YLHKSZFLQXTQKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-14(2)10-15(9-12(14)13(16)17)8-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,16,17).
What are the key properties of 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid?
1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid has a molecular weight of 233.31 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 5081554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).